C24H26F6N2O2 — CID 15504688
(3aS,4S,7R,7aR)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-7-methyl-4-phenyl-2,3,3a,5,6,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-7-ol (PubChem CID 15504688) has the molecular formula C24H26F6N2O2 and a molecular weight of 488.47 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-7-methyl-4-phenyl-2,3,3a,5,6,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-7-ol.
| Compound Name | (3aS,4S,7R,7aR)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-7-methyl-4-phenyl-2,3,3a,5,6,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-7-ol |
|---|---|
| PubChem CID | 15504688 |
| Molecular Formula | C24H26F6N2O2 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (3aS,4S,7R,7aR)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-7-methyl-4-phenyl-2,3,3a,5,6,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-7-ol |
| SMILES | C[C@]1(O)CN[C@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C24H26F6N2O2/c1-21(33)13-32-22(16-5-3-2-4-6-16,20-11-31-10-19(20)21)14-34-12-15-7-17(23(25,26)27)9-18(8-15)24(28,29)30/h2-9,19-20,31-33H,10-14H2,1H3/t19-,20+,21-,22+/m0/s1 |
| InChIKey | QTANAPKICPTBCE-LNRXMEIDSA-N |
| XLogP | 4.33 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |