C30H30F3N5O3S — CID 155046917
1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]propan-2-yl]urea (PubChem CID 155046917) has the molecular formula C30H30F3N5O3S and a molecular weight of 597.66 g/mol. Its IUPAC name is 1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]propan-2-yl]urea.
| Compound Name | 1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 155046917 |
| Molecular Formula | C30H30F3N5O3S |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]propan-2-yl]urea |
| SMILES | CC(Cc1ccc(NC(=O)Nc2ccc(C(F)(F)F)cc2)cc1)NC(=O)N=C1SCC(=O)N1c1ccccc1C(C)C |
| InChI | InChI=1S/C30H30F3N5O3S/c1-18(2)24-6-4-5-7-25(24)38-26(39)17-42-29(38)37-27(40)34-19(3)16-20-8-12-22(13-9-20)35-28(41)36-23-14-10-21(11-15-23)30(31,32)33/h4-15,18-19H,16-17H2,1-3H3,(H,34,40)(H2,35,36,41) |
| InChIKey | JKVZHPJSDFQZBJ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|