C18H35F3S2 — CID 155048637
7-[(1R)-1-(ethyldisulfanyl)-3,3,3-trifluoropropyl]tridecane (PubChem CID 155048637) has the molecular formula C18H35F3S2 and a molecular weight of 372.61 g/mol. Its IUPAC name is 7-[(1R)-1-(ethyldisulfanyl)-3,3,3-trifluoropropyl]tridecane.
| Compound Name | 7-[(1R)-1-(ethyldisulfanyl)-3,3,3-trifluoropropyl]tridecane |
|---|---|
| PubChem CID | 155048637 |
| Molecular Formula | C18H35F3S2 |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 7-[(1R)-1-(ethyldisulfanyl)-3,3,3-trifluoropropyl]tridecane |
| SMILES | CCCCCCC(CCCCCC)[C@@H](CC(F)(F)F)SSCC |
| InChI | InChI=1S/C18H35F3S2/c1-4-7-9-11-13-16(14-12-10-8-5-2)17(23-22-6-3)15-18(19,20)21/h16-17H,4-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | NOVJOFKUQCLEOU-QGZVFWFLSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|