C13H19F — CID 155053248
(9Z)-9-fluoro-5,6-dimethylideneundeca-1,9-diene (PubChem CID 155053248) has the molecular formula C13H19F and a molecular weight of 194.29 g/mol. Its IUPAC name is (9Z)-9-fluoro-5,6-dimethylideneundeca-1,9-diene.
| Compound Name | (9Z)-9-fluoro-5,6-dimethylideneundeca-1,9-diene |
|---|---|
| PubChem CID | 155053248 |
| Molecular Formula | C13H19F |
| Molecular Weight | 194.29 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (9Z)-9-fluoro-5,6-dimethylideneundeca-1,9-diene |
| SMILES | C=CCCC(=C)C(=C)CC/C(F)=C/C |
| InChI | InChI=1S/C13H19F/c1-5-7-8-11(3)12(4)9-10-13(14)6-2/h5-6H,1,3-4,7-10H2,2H3/b13-6- |
| InChIKey | LYZLSPPIONVCEU-MLPAPPSSSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|