C13H25N — CID 155053642
5-methyl-N,N-dipropylhexa-1,4-dien-2-amine (PubChem CID 155053642) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 5-methyl-N,N-dipropylhexa-1,4-dien-2-amine.
| Compound Name | 5-methyl-N,N-dipropylhexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 155053642 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 5-methyl-N,N-dipropylhexa-1,4-dien-2-amine |
| SMILES | C=C(CC=C(C)C)N(CCC)CCC |
| InChI | InChI=1S/C13H25N/c1-6-10-14(11-7-2)13(5)9-8-12(3)4/h8H,5-7,9-11H2,1-4H3 |
| InChIKey | QEAJVYBBWWUTHJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|