C10H16S — CID 142129414
(3E)-2,7-dimethylocta-1,3,6-triene-4-thiol (PubChem CID 142129414) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is (3E)-2,7-dimethylocta-1,3,6-triene-4-thiol.
| Compound Name | (3E)-2,7-dimethylocta-1,3,6-triene-4-thiol |
|---|---|
| PubChem CID | 142129414 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (3E)-2,7-dimethylocta-1,3,6-triene-4-thiol |
| SMILES | C=C(C)/C=C(/S)CC=C(C)C |
| InChI | InChI=1S/C10H16S/c1-8(2)5-6-10(11)7-9(3)4/h5,7,11H,3,6H2,1-2,4H3/b10-7+ |
| InChIKey | IWEAURNNNVSMPL-JXMROGBWSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|