C12H12Cl2N2O2 — CID 155055633
3-chloro-6-[4-chloro-2-(methoxymethoxy)phenyl]-1,2-dihydropyridazine (PubChem CID 155055633) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is 3-chloro-6-[4-chloro-2-(methoxymethoxy)phenyl]-1,2-dihydropyridazine.
| Compound Name | 3-chloro-6-[4-chloro-2-(methoxymethoxy)phenyl]-1,2-dihydropyridazine |
|---|---|
| PubChem CID | 155055633 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-chloro-6-[4-chloro-2-(methoxymethoxy)phenyl]-1,2-dihydropyridazine |
| SMILES | COCOc1cc(Cl)ccc1C1=CC=C(Cl)NN1 |
| InChI | InChI=1S/C12H12Cl2N2O2/c1-17-7-18-11-6-8(13)2-3-9(11)10-4-5-12(14)16-15-10/h2-6,15-16H,7H2,1H3 |
| InChIKey | ALGRGAZERFSFMA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|