C10H8BrClN2O2S — CID 167369137
2-bromo-5-[4-chloro-2-(methoxymethoxy)phenyl]-1,3,4-thiadiazole (PubChem CID 167369137) has the molecular formula C10H8BrClN2O2S and a molecular weight of 335.61 g/mol. Its IUPAC name is 2-bromo-5-[4-chloro-2-(methoxymethoxy)phenyl]-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-[4-chloro-2-(methoxymethoxy)phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 167369137 |
| Molecular Formula | C10H8BrClN2O2S |
| Molecular Weight | 335.61 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 2-bromo-5-[4-chloro-2-(methoxymethoxy)phenyl]-1,3,4-thiadiazole |
| SMILES | COCOc1cc(Cl)ccc1-c1nnc(Br)s1 |
| InChI | InChI=1S/C10H8BrClN2O2S/c1-15-5-16-8-4-6(12)2-3-7(8)9-13-14-10(11)17-9/h2-4H,5H2,1H3 |
| InChIKey | DUWCTZSHMATEKI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|