C22H24ClN3O2 — CID 170038093
7-[(5S)-3-bicyclo[3.2.1]octanyl]-3-[4-chloro-2-(methoxymethoxy)phenyl]pyrrolo[2,3-c]pyridazine (PubChem CID 170038093) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 7-[(5S)-3-bicyclo[3.2.1]octanyl]-3-[4-chloro-2-(methoxymethoxy)phenyl]pyrrolo[2,3-c]pyridazine.
| Compound Name | 7-[(5S)-3-bicyclo[3.2.1]octanyl]-3-[4-chloro-2-(methoxymethoxy)phenyl]pyrrolo[2,3-c]pyridazine |
|---|---|
| PubChem CID | 170038093 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 7-[(5S)-3-bicyclo[3.2.1]octanyl]-3-[4-chloro-2-(methoxymethoxy)phenyl]pyrrolo[2,3-c]pyridazine |
| SMILES | COCOc1cc(Cl)ccc1-c1cc2ccn(C3CC4CC[C@@H](C4)C3)c2nn1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-27-13-28-21-12-17(23)4-5-19(21)20-11-16-6-7-26(22(16)25-24-20)18-9-14-2-3-15(8-14)10-18/h4-7,11-12,14-15,18H,2-3,8-10,13H2,1H3/t14-,15?,18?/m0/s1 |
| InChIKey | FXCZRSIKGUDQFX-SYJJWHGVSA-N |
| XLogP | 5.49 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|