C23H27BClN3O3S — CID 168845947
[3-[3-[4-chloro-2-(methoxymethoxy)phenyl]-6H-thiopyrano[3,2-c]pyridazin-8-yl]-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid (PubChem CID 168845947) has the molecular formula C23H27BClN3O3S and a molecular weight of 471.82 g/mol. Its IUPAC name is [3-[3-[4-chloro-2-(methoxymethoxy)phenyl]-6H-thiopyrano[3,2-c]pyridazin-8-yl]-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid.
| Compound Name | [3-[3-[4-chloro-2-(methoxymethoxy)phenyl]-6H-thiopyrano[3,2-c]pyridazin-8-yl]-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
|---|---|
| PubChem CID | 168845947 |
| Molecular Formula | C23H27BClN3O3S |
| Molecular Weight | 471.82 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | [3-[3-[4-chloro-2-(methoxymethoxy)phenyl]-6H-thiopyrano[3,2-c]pyridazin-8-yl]-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
| SMILES | COCOc1cc(Cl)ccc1-c1cc2c(nn1)C(C1CC3CCC(C1)N3B(C)O)=CCS2 |
| InChI | InChI=1S/C23H27BClN3O3S/c1-24(29)28-16-4-5-17(28)10-14(9-16)18-7-8-32-22-12-20(26-27-23(18)22)19-6-3-15(25)11-21(19)31-13-30-2/h3,6-7,11-12,14,16-17,29H,4-5,8-10,13H2,1-2H3 |
| InChIKey | BAKZBVISBPHQCT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|