C25H38O5 — CID 155062663
(2S)-2-methyl-3-[[(8R,9R,10S,13S,14R,17R)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyloxy]propanoic acid (PubChem CID 155062663) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (2S)-2-methyl-3-[[(8R,9R,10S,13S,14R,17R)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyloxy]propanoic acid.
| Compound Name | (2S)-2-methyl-3-[[(8R,9R,10S,13S,14R,17R)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyloxy]propanoic acid |
|---|---|
| PubChem CID | 155062663 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (2S)-2-methyl-3-[[(8R,9R,10S,13S,14R,17R)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyloxy]propanoic acid |
| SMILES | C[C@@H]1CC[C@@H]2[C@H]3CC=C4CC(OC(=O)OC[C@H](C)C(=O)O)CC[C@@]4(C)[C@@H]3CC[C@@]12C |
| InChI | InChI=1S/C25H38O5/c1-15(22(26)27)14-29-23(28)30-18-9-11-25(4)17(13-18)6-7-19-20-8-5-16(2)24(20,3)12-10-21(19)25/h6,15-16,18-21H,5,7-14H2,1-4H3,(H,26,27)/t15-,16+,18?,19+,20+,21+,24-,25+/m0/s1 |
| InChIKey | PXOZJNLMCIURQT-RKYSSPPDSA-N |
| XLogP | 5.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|