C27H43NO3 — CID 142957552
(10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-(6-oxohexyl)carbamate (PubChem CID 142957552) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is (10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-(6-oxohexyl)carbamate.
| Compound Name | (10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-(6-oxohexyl)carbamate |
|---|---|
| PubChem CID | 142957552 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | (10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) N-(6-oxohexyl)carbamate |
| SMILES | CC1CCC2C3CC=C4CC(OC(=O)NCCCCCC=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H43NO3/c1-19-8-11-23-22-10-9-20-18-21(31-25(30)28-16-6-4-5-7-17-29)12-14-27(20,3)24(22)13-15-26(19,23)2/h9,17,19,21-24H,4-8,10-16,18H2,1-3H3,(H,28,30) |
| InChIKey | FMGAKKDNTBFRCC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|