C17H32N2O3S2 — CID 155062879
4-[(1-acetamido-2-methylpropan-2-yl)disulfanyl]-4-methyl-N-(3-oxopentyl)pentanamide (PubChem CID 155062879) has the molecular formula C17H32N2O3S2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 4-[(1-acetamido-2-methylpropan-2-yl)disulfanyl]-4-methyl-N-(3-oxopentyl)pentanamide.
| Compound Name | 4-[(1-acetamido-2-methylpropan-2-yl)disulfanyl]-4-methyl-N-(3-oxopentyl)pentanamide |
|---|---|
| PubChem CID | 155062879 |
| Molecular Formula | C17H32N2O3S2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[(1-acetamido-2-methylpropan-2-yl)disulfanyl]-4-methyl-N-(3-oxopentyl)pentanamide |
| SMILES | CCC(=O)CCNC(=O)CCC(C)(C)SSC(C)(C)CNC(C)=O |
| InChI | InChI=1S/C17H32N2O3S2/c1-7-14(21)9-11-18-15(22)8-10-16(3,4)23-24-17(5,6)12-19-13(2)20/h7-12H2,1-6H3,(H,18,22)(H,19,20) |
| InChIKey | IBGUYMYOGRXQDM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|