C18H25NO3 — CID 155064659
2,4-dihydroxy-N-methyl-N-[(Z)-2-methylidenehex-3-enyl]-5-propan-2-ylbenzamide (PubChem CID 155064659) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2,4-dihydroxy-N-methyl-N-[(Z)-2-methylidenehex-3-enyl]-5-propan-2-ylbenzamide.
| Compound Name | 2,4-dihydroxy-N-methyl-N-[(Z)-2-methylidenehex-3-enyl]-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 155064659 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2,4-dihydroxy-N-methyl-N-[(Z)-2-methylidenehex-3-enyl]-5-propan-2-ylbenzamide |
| SMILES | C=C(/C=C\CC)CN(C)C(=O)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C18H25NO3/c1-6-7-8-13(4)11-19(5)18(22)15-9-14(12(2)3)16(20)10-17(15)21/h7-10,12,20-21H,4,6,11H2,1-3,5H3/b8-7- |
| InChIKey | BXYPNTJBLVOZJN-FPLPWBNLSA-N |
| XLogP | 3.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|