C23H43N3O3 — CID 155070136
(E,5S)-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-7-methyl-5-(pentanoylamino)oct-3-enamide (PubChem CID 155070136) has the molecular formula C23H43N3O3 and a molecular weight of 409.62 g/mol. Its IUPAC name is (E,5S)-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-7-methyl-5-(pentanoylamino)oct-3-enamide.
| Compound Name | (E,5S)-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-7-methyl-5-(pentanoylamino)oct-3-enamide |
|---|---|
| PubChem CID | 155070136 |
| Molecular Formula | C23H43N3O3 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | (E,5S)-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-7-methyl-5-(pentanoylamino)oct-3-enamide |
| SMILES | CCCCC(=O)N[C@H](/C=C/CC(=O)NC1CC(C)(C)N(O)C(C)(C)C1)CC(C)C |
| InChI | InChI=1S/C23H43N3O3/c1-8-9-12-20(27)24-18(14-17(2)3)11-10-13-21(28)25-19-15-22(4,5)26(29)23(6,7)16-19/h10-11,17-19,29H,8-9,12-16H2,1-7H3,(H,24,27)(H,25,28)/b11-10+/t18-/m1/s1 |
| InChIKey | BOWDRBDYKFJRAB-DOJUMQAQSA-N |
| XLogP | 4.18 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|