C13H28FN3 — CID 155072623
N-(3-aminopropyl)-N'-[(E)-1-fluorohex-2-en-3-yl]butane-1,4-diamine (PubChem CID 155072623) has the molecular formula C13H28FN3 and a molecular weight of 245.39 g/mol. Its IUPAC name is N-(3-aminopropyl)-N'-[(E)-1-fluorohex-2-en-3-yl]butane-1,4-diamine.
| Compound Name | N-(3-aminopropyl)-N'-[(E)-1-fluorohex-2-en-3-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 155072623 |
| Molecular Formula | C13H28FN3 |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.23 |
| IUPAC Name | N-(3-aminopropyl)-N'-[(E)-1-fluorohex-2-en-3-yl]butane-1,4-diamine |
| SMILES | CCC/C(=C\CF)NCCCCNCCCN |
| InChI | InChI=1S/C13H28FN3/c1-2-6-13(7-8-14)17-12-4-3-10-16-11-5-9-15/h7,16-17H,2-6,8-12,15H2,1H3/b13-7+ |
| InChIKey | CYCKHFSMRGNQMP-NTUHNPAUSA-N |
| XLogP | 1.95 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|