C12H25FN2 — CID 143779678
(Z)-3-fluoro-4-N,4-N-dimethyl-1-N-propylhept-3-ene-1,4-diamine (PubChem CID 143779678) has the molecular formula C12H25FN2 and a molecular weight of 216.34 g/mol. Its IUPAC name is (Z)-3-fluoro-4-N,4-N-dimethyl-1-N-propylhept-3-ene-1,4-diamine.
| Compound Name | (Z)-3-fluoro-4-N,4-N-dimethyl-1-N-propylhept-3-ene-1,4-diamine |
|---|---|
| PubChem CID | 143779678 |
| Molecular Formula | C12H25FN2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | (Z)-3-fluoro-4-N,4-N-dimethyl-1-N-propylhept-3-ene-1,4-diamine |
| SMILES | CCCNCC/C(F)=C(\CCC)N(C)C |
| InChI | InChI=1S/C12H25FN2/c1-5-7-12(15(3)4)11(13)8-10-14-9-6-2/h14H,5-10H2,1-4H3/b12-11- |
| InChIKey | WEQDDTYIGMTTRZ-QXMHVHEDSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|