C8H16N2 — CID 167037379
6-propan-2-yl-1,2,3,4-tetrahydropyridin-5-amine (PubChem CID 167037379) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 6-propan-2-yl-1,2,3,4-tetrahydropyridin-5-amine.
| Compound Name | 6-propan-2-yl-1,2,3,4-tetrahydropyridin-5-amine |
|---|---|
| PubChem CID | 167037379 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 6-propan-2-yl-1,2,3,4-tetrahydropyridin-5-amine |
| SMILES | CC(C)C1=C(N)CCCN1 |
| InChI | InChI=1S/C8H16N2/c1-6(2)8-7(9)4-3-5-10-8/h6,10H,3-5,9H2,1-2H3 |
| InChIKey | KOJNPAQNNYBNLB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |