C16H29N — CID 155073643
N-methyltricyclo[8.3.1.13,7]pentadecan-4-amine (PubChem CID 155073643) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is N-methyltricyclo[8.3.1.13,7]pentadecan-4-amine.
| Compound Name | N-methyltricyclo[8.3.1.13,7]pentadecan-4-amine |
|---|---|
| PubChem CID | 155073643 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N-methyltricyclo[8.3.1.13,7]pentadecan-4-amine |
| SMILES | CNC1CCC2CCC3CCCC(C3)CC1C2 |
| InChI | InChI=1S/C16H29N/c1-17-16-8-7-13-6-5-12-3-2-4-14(9-12)11-15(16)10-13/h12-17H,2-11H2,1H3 |
| InChIKey | DBVONZWEVGPISS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |