C8H12O5S2 — CID 155075210
4-[3,3-bis(sulfanyl)butanoyloxy]-4-oxobutanoic acid (PubChem CID 155075210) has the molecular formula C8H12O5S2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-[3,3-bis(sulfanyl)butanoyloxy]-4-oxobutanoic acid.
| Compound Name | 4-[3,3-bis(sulfanyl)butanoyloxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155075210 |
| Molecular Formula | C8H12O5S2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 4-[3,3-bis(sulfanyl)butanoyloxy]-4-oxobutanoic acid |
| SMILES | CC(S)(S)CC(=O)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C8H12O5S2/c1-8(14,15)4-7(12)13-6(11)3-2-5(9)10/h14-15H,2-4H2,1H3,(H,9,10) |
| InChIKey | CPAYHKKWNYMYQY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|