C29H23F6N3O8 — CID 155090186
[(3S)-3-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentyl] phenyl carbonate (PubChem CID 155090186) has the molecular formula C29H23F6N3O8 and a molecular weight of 655.50 g/mol. Its IUPAC name is [(3S)-3-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentyl] phenyl carbonate.
| Compound Name | [(3S)-3-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentyl] phenyl carbonate |
|---|---|
| PubChem CID | 155090186 |
| Molecular Formula | C29H23F6N3O8 |
| Molecular Weight | 655.50 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | [(3S)-3-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentyl] phenyl carbonate |
| SMILES | C[C@H](NC(=O)C(=O)Nc1c(F)cccc1F)C(=O)N[C@@H](CCOC(=O)Oc1ccccc1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C29H23F6N3O8/c1-14(36-27(41)28(42)38-24-16(30)8-5-9-17(24)31)26(40)37-20(10-11-44-29(43)46-15-6-3-2-4-7-15)21(39)13-45-25-22(34)18(32)12-19(33)23(25)35/h2-9,12,14,20H,10-11,13H2,1H3,(H,36,41)(H,37,40)(H,38,42)/t14-,20-/m0/s1 |
| InChIKey | ISAZZBSSTWRQHM-XOBRGWDASA-N |
| XLogP | 3.70 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|