C26H25F6N3O7 — CID 155612786
butyl (4S)-4-[[2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]acetyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoate (PubChem CID 155612786) has the molecular formula C26H25F6N3O7 and a molecular weight of 605.49 g/mol. Its IUPAC name is butyl (4S)-4-[[2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]acetyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoate.
| Compound Name | butyl (4S)-4-[[2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]acetyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoate |
|---|---|
| PubChem CID | 155612786 |
| Molecular Formula | C26H25F6N3O7 |
| Molecular Weight | 605.49 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | butyl (4S)-4-[[2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]acetyl]amino]-5-oxo-6-(2,3,5,6-tetrafluorophenoxy)hexanoate |
| SMILES | CCCCOC(=O)CC[C@H](NC(=O)CNC(=O)C(=O)Nc1c(F)cccc1F)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C26H25F6N3O7/c1-2-3-9-41-20(38)8-7-17(18(36)12-42-24-21(31)15(29)10-16(30)22(24)32)34-19(37)11-33-25(39)26(40)35-23-13(27)5-4-6-14(23)28/h4-6,10,17H,2-3,7-9,11-12H2,1H3,(H,33,39)(H,34,37)(H,35,40)/t17-/m0/s1 |
| InChIKey | KTUIYVWMVBNSPT-KRWDZBQOSA-N |
| XLogP | 2.83 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|