C24H20F7N3O7 — CID 155090076
(4S)-5-oxo-4-[[(2S)-2-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]propanoyl]amino]-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid (PubChem CID 155090076) has the molecular formula C24H20F7N3O7 and a molecular weight of 595.42 g/mol. Its IUPAC name is (4S)-5-oxo-4-[[(2S)-2-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]propanoyl]amino]-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid.
| Compound Name | (4S)-5-oxo-4-[[(2S)-2-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]propanoyl]amino]-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid |
|---|---|
| PubChem CID | 155090076 |
| Molecular Formula | C24H20F7N3O7 |
| Molecular Weight | 595.42 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | (4S)-5-oxo-4-[[(2S)-2-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]propanoyl]amino]-6-(2,3,5,6-tetrafluorophenoxy)hexanoic acid |
| SMILES | C[C@H](NC(=O)C(=O)Nc1ccc(C(F)(F)F)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H20F7N3O7/c1-10(32-22(39)23(40)33-12-4-2-11(3-5-12)24(29,30)31)21(38)34-15(6-7-17(36)37)16(35)9-41-20-18(27)13(25)8-14(26)19(20)28/h2-5,8,10,15H,6-7,9H2,1H3,(H,32,39)(H,33,40)(H,34,38)(H,36,37)/t10-,15-/m0/s1 |
| InChIKey | INJLLCPCVRBJLU-BONVTDFDSA-N |
| XLogP | 2.70 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|