C13H17FN4O3 — CID 155092287
[5-[(4-fluoroanilino)carbamoyl]-1-methylpyrrolidin-3-yl] carbamate (PubChem CID 155092287) has the molecular formula C13H17FN4O3 and a molecular weight of 296.30 g/mol. Its IUPAC name is [5-[(4-fluoroanilino)carbamoyl]-1-methylpyrrolidin-3-yl] carbamate.
| Compound Name | [5-[(4-fluoroanilino)carbamoyl]-1-methylpyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 155092287 |
| Molecular Formula | C13H17FN4O3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [5-[(4-fluoroanilino)carbamoyl]-1-methylpyrrolidin-3-yl] carbamate |
| SMILES | CN1CC(OC(N)=O)CC1C(=O)NNc1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN4O3/c1-18-7-10(21-13(15)20)6-11(18)12(19)17-16-9-4-2-8(14)3-5-9/h2-5,10-11,16H,6-7H2,1H3,(H2,15,20)(H,17,19) |
| InChIKey | DXUJAXJMXJZYAU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|