C15H17F3N4O2 — CID 134210028
N-cyclopropyl-4,4-difluoro-2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carboxamide (PubChem CID 134210028) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is N-cyclopropyl-4,4-difluoro-2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carboxamide.
| Compound Name | N-cyclopropyl-4,4-difluoro-2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 134210028 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-cyclopropyl-4,4-difluoro-2-[(4-fluoroanilino)carbamoyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NNc1ccc(F)cc1)C1CC(F)(F)CN1C(=O)NC1CC1 |
| InChI | InChI=1S/C15H17F3N4O2/c16-9-1-3-11(4-2-9)20-21-13(23)12-7-15(17,18)8-22(12)14(24)19-10-5-6-10/h1-4,10,12,20H,5-8H2,(H,19,24)(H,21,23) |
| InChIKey | RXLBQRJHCPWGMJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|