C13H15NS — CID 155095870
2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]pyridine (PubChem CID 155095870) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]pyridine.
| Compound Name | 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]pyridine |
|---|---|
| PubChem CID | 155095870 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]pyridine |
| SMILES | C=CC(=C)S/C(C)=C(/C)c1ccccn1 |
| InChI | InChI=1S/C13H15NS/c1-5-10(2)15-12(4)11(3)13-8-6-7-9-14-13/h5-9H,1-2H2,3-4H3/b12-11- |
| InChIKey | YTOHSBRVIAETAR-QXMHVHEDSA-N |
| XLogP | 4.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|