C21H27N5O4S — CID 155107276
6-[[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylamino]sulfanylamino]hexanoic acid (PubChem CID 155107276) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is 6-[[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylamino]sulfanylamino]hexanoic acid.
| Compound Name | 6-[[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylamino]sulfanylamino]hexanoic acid |
|---|---|
| PubChem CID | 155107276 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 6-[[[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]methylamino]sulfanylamino]hexanoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(CNSNCCCCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H27N5O4S/c22-21(23)26-17-9-7-16(8-10-17)20(29)30-18-11-5-15(6-12-18)14-25-31-24-13-3-1-2-4-19(27)28/h5-12,24-25H,1-4,13-14H2,(H,27,28)(H4,22,23,26) |
| InChIKey | UCZLTWHTOJPXQT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|