C12H19NO2 — CID 155108050
methyl N-[(2E,4Z)-7-methoxyocta-2,4,7-trien-2-yl]ethanimidate (PubChem CID 155108050) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl N-[(2E,4Z)-7-methoxyocta-2,4,7-trien-2-yl]ethanimidate.
| Compound Name | methyl N-[(2E,4Z)-7-methoxyocta-2,4,7-trien-2-yl]ethanimidate |
|---|---|
| PubChem CID | 155108050 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl N-[(2E,4Z)-7-methoxyocta-2,4,7-trien-2-yl]ethanimidate |
| SMILES | C=C(C/C=C\C=C(C)\N=C(/C)OC)OC |
| InChI | InChI=1S/C12H19NO2/c1-10(13-12(3)15-5)8-6-7-9-11(2)14-4/h6-8H,2,9H2,1,3-5H3/b7-6-,10-8+,13-12+ |
| InChIKey | KHIORYCEDQTWON-DVOKJYLESA-N |
| XLogP | 3.06 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|