C14H18N2O — CID 155118496
2,4-dimethyl-4,5,6,7-tetrahydro-3H-1,7-benzodiazecin-8-one (PubChem CID 155118496) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,4-dimethyl-4,5,6,7-tetrahydro-3H-1,7-benzodiazecin-8-one.
| Compound Name | 2,4-dimethyl-4,5,6,7-tetrahydro-3H-1,7-benzodiazecin-8-one |
|---|---|
| PubChem CID | 155118496 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2,4-dimethyl-4,5,6,7-tetrahydro-3H-1,7-benzodiazecin-8-one |
| SMILES | C/C1=N\c2ccccc2C(=O)NCCC(C)C1 |
| InChI | InChI=1S/C14H18N2O/c1-10-7-8-15-14(17)12-5-3-4-6-13(12)16-11(2)9-10/h3-6,10H,7-9H2,1-2H3,(H,15,17)/b16-11+ |
| InChIKey | GJRUDCBKVUZOJM-LFIBNONCSA-N |
| XLogP | 2.94 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |