About 2-methylidene-6-propyl-3H-1,3-benzothiazole
2-methylidene-6-propyl-3H-1,3-benzothiazole (PubChem CID 155132421) has the molecular formula C11H13NS
and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-methylidene-6-propyl-3H-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-methylidene-6-propyl-3H-1,3-benzothiazole |
| PubChem CID | 155132421 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-methylidene-6-propyl-3H-1,3-benzothiazole |
| SMILES | C=C1Nc2ccc(CCC)cc2S1 |
| InChI | InChI=1S/C11H13NS/c1-3-4-9-5-6-10-11(7-9)13-8(2)12-10/h5-7,12H,2-4H2,1H3 |
| InChIKey | ADKSVAKPDTWRNB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylidene-6-propyl-3H-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-6-propyl-3H-1,3-benzothiazole?
The IUPAC name of 2-methylidene-6-propyl-3H-1,3-benzothiazole (CID 155132421) is 2-methylidene-6-propyl-3H-1,3-benzothiazole.
What is the SMILES notation for 2-methylidene-6-propyl-3H-1,3-benzothiazole?
The canonical SMILES for 2-methylidene-6-propyl-3H-1,3-benzothiazole is C=C1Nc2ccc(CCC)cc2S1.
What is the InChIKey of 2-methylidene-6-propyl-3H-1,3-benzothiazole?
The InChIKey is ADKSVAKPDTWRNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS/c1-3-4-9-5-6-10-11(7-9)13-8(2)12-10/h5-7,12H,2-4H2,1H3.
What are the key properties of 2-methylidene-6-propyl-3H-1,3-benzothiazole?
2-methylidene-6-propyl-3H-1,3-benzothiazole has a molecular weight of 191.30 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-6-propyl-3H-1,3-benzothiazole is sourced from PubChem (CID 155132421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).