C40H53FO9 — CID 155156774
diethyl 2-[[5-ethyl-4-(2-fluoro-4-heptylphenyl)-2-(3-prop-2-enoyloxypropyl)phenoxy]methyl]-2-(2-prop-2-enoyloxyethyl)propanedioate (PubChem CID 155156774) has the molecular formula C40H53FO9 and a molecular weight of 696.85 g/mol. Its IUPAC name is diethyl 2-[[5-ethyl-4-(2-fluoro-4-heptylphenyl)-2-(3-prop-2-enoyloxypropyl)phenoxy]methyl]-2-(2-prop-2-enoyloxyethyl)propanedioate.
| Compound Name | diethyl 2-[[5-ethyl-4-(2-fluoro-4-heptylphenyl)-2-(3-prop-2-enoyloxypropyl)phenoxy]methyl]-2-(2-prop-2-enoyloxyethyl)propanedioate |
|---|---|
| PubChem CID | 155156774 |
| Molecular Formula | C40H53FO9 |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.37 |
| IUPAC Name | diethyl 2-[[5-ethyl-4-(2-fluoro-4-heptylphenyl)-2-(3-prop-2-enoyloxypropyl)phenoxy]methyl]-2-(2-prop-2-enoyloxyethyl)propanedioate |
| SMILES | C=CC(=O)OCCCc1cc(-c2ccc(CCCCCCC)cc2F)c(CC)cc1OCC(CCOC(=O)C=C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C40H53FO9/c1-7-13-14-15-16-18-29-20-21-32(34(41)25-29)33-26-31(19-17-23-48-36(42)9-3)35(27-30(33)8-2)50-28-40(38(44)46-11-5,39(45)47-12-6)22-24-49-37(43)10-4/h9-10,20-21,25-27H,3-4,7-8,11-19,22-24,28H2,1-2,5-6H3 |
| InChIKey | LRDHIQSEMBCXJZ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|