C30H47NO6 — CID 155158975
1-O-[1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-yl] 4-O-(2,4,4-trimethylpentan-2-yl) (Z)-but-2-enedioate (PubChem CID 155158975) has the molecular formula C30H47NO6 and a molecular weight of 517.71 g/mol. Its IUPAC name is 1-O-[1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-yl] 4-O-(2,4,4-trimethylpentan-2-yl) (Z)-but-2-enedioate.
| Compound Name | 1-O-[1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-yl] 4-O-(2,4,4-trimethylpentan-2-yl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 155158975 |
| Molecular Formula | C30H47NO6 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | 1-O-[1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-yl] 4-O-(2,4,4-trimethylpentan-2-yl) (Z)-but-2-enedioate |
| SMILES | CC(C)NCC(COc1ccc(CCOCC2CC2)cc1)OC(=O)/C=C\C(=O)OC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C30H47NO6/c1-22(2)31-18-26(36-27(32)14-15-28(33)37-30(6,7)21-29(3,4)5)20-35-25-12-10-23(11-13-25)16-17-34-19-24-8-9-24/h10-15,22,24,26,31H,8-9,16-21H2,1-7H3/b15-14- |
| InChIKey | GNBXCHPTZIDORM-PFONDFGASA-N |
| XLogP | 5.26 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|