C18H30ClNO3 — CID 18782098
1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-1-ol;hydrochloride (PubChem CID 18782098) has the molecular formula C18H30ClNO3 and a molecular weight of 343.89 g/mol. Its IUPAC name is 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-1-ol;hydrochloride.
| Compound Name | 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 18782098 |
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.89 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-1-ol;hydrochloride |
| SMILES | CC(C)NCCC(O)Oc1ccc(CCOCC2CC2)cc1.Cl |
| InChI | InChI=1S/C18H29NO3.ClH/c1-14(2)19-11-9-18(20)22-17-7-5-15(6-8-17)10-12-21-13-16-3-4-16;/h5-8,14,16,18-20H,3-4,9-13H2,1-2H3;1H |
| InChIKey | UWTPGPGYFLMAET-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|