C21H35NO4 — CID 90765056
1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-[(propan-2-ylamino)methyl]pentane-2,3-diol (PubChem CID 90765056) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-[(propan-2-ylamino)methyl]pentane-2,3-diol.
| Compound Name | 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-[(propan-2-ylamino)methyl]pentane-2,3-diol |
|---|---|
| PubChem CID | 90765056 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-2-[(propan-2-ylamino)methyl]pentane-2,3-diol |
| SMILES | CCC(O)C(O)(CNC(C)C)COc1ccc(CCOCC2CC2)cc1 |
| InChI | InChI=1S/C21H35NO4/c1-4-20(23)21(24,14-22-16(2)3)15-26-19-9-7-17(8-10-19)11-12-25-13-18-5-6-18/h7-10,16,18,20,22-24H,4-6,11-15H2,1-3H3 |
| InChIKey | LEUSVULJMMAFJV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|