C23H38O3 — CID 155162574
(3Z,6S,7R,8E,10E,14E,16S,18Z)-tricosa-3,8,10,14,18-pentaene-6,7,16-triol (PubChem CID 155162574) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (3Z,6S,7R,8E,10E,14E,16S,18Z)-tricosa-3,8,10,14,18-pentaene-6,7,16-triol.
| Compound Name | (3Z,6S,7R,8E,10E,14E,16S,18Z)-tricosa-3,8,10,14,18-pentaene-6,7,16-triol |
|---|---|
| PubChem CID | 155162574 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (3Z,6S,7R,8E,10E,14E,16S,18Z)-tricosa-3,8,10,14,18-pentaene-6,7,16-triol |
| SMILES | CC/C=C\C[C@H](O)[C@H](O)/C=C/C=C/CC/C=C/[C@@H](O)C/C=C\CCCC |
| InChI | InChI=1S/C23H38O3/c1-3-5-7-10-14-17-21(24)18-15-11-8-9-12-16-20-23(26)22(25)19-13-6-4-2/h6,9-10,12-16,18,20-26H,3-5,7-8,11,17,19H2,1-2H3/b12-9+,13-6-,14-10-,18-15+,20-16+/t21-,22-,23+/m0/s1 |
| InChIKey | GFONPKNZEYRHRQ-IMKYISEQSA-N |
| XLogP | 5.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|