C19H17NO4 — CID 15516574
(E)-3-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]phenyl]prop-2-enoic acid (PubChem CID 15516574) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (E)-3-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15516574 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (E)-3-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(CCCn2c(=O)oc3ccccc32)cc1 |
| InChI | InChI=1S/C19H17NO4/c21-18(22)12-11-15-9-7-14(8-10-15)4-3-13-20-16-5-1-2-6-17(16)24-19(20)23/h1-2,5-12H,3-4,13H2,(H,21,22)/b12-11+ |
| InChIKey | VMGFOBYIRSOIGR-VAWYXSNFSA-N |
| XLogP | 3.33 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|