C15H10O4 — CID 15517839
2-(3,4-dihydroxyphenyl)chromen-7-one (PubChem CID 15517839) has the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)chromen-7-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)chromen-7-one |
|---|---|
| PubChem CID | 15517839 |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)chromen-7-one |
| SMILES | O=c1ccc2ccc(-c3ccc(O)c(O)c3)oc-2c1 |
| InChI | InChI=1S/C15H10O4/c16-11-4-1-9-3-6-14(19-15(9)8-11)10-2-5-12(17)13(18)7-10/h1-8,17-18H |
| InChIKey | PORSUXNBDMJHCP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|