C10H11ClIN — CID 155205670
6-chloro-5-iodo-N-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 155205670) has the molecular formula C10H11ClIN and a molecular weight of 307.56 g/mol. Its IUPAC name is 6-chloro-5-iodo-N-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 6-chloro-5-iodo-N-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 155205670 |
| Molecular Formula | C10H11ClIN |
| Molecular Weight | 307.56 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 6-chloro-5-iodo-N-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CNC1CCc2cc(I)c(Cl)cc21 |
| InChI | InChI=1S/C10H11ClIN/c1-13-10-3-2-6-4-9(12)8(11)5-7(6)10/h4-5,10,13H,2-3H2,1H3 |
| InChIKey | XBUMCLHNUJYZMM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|