About N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide
N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide (PubChem CID 59966268) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide |
| PubChem CID | 59966268 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide |
| SMILES | CNC1CCc2ccc(/N=C/N(C)C)cc21 |
| InChI | InChI=1S/C13H19N3/c1-14-13-7-5-10-4-6-11(8-12(10)13)15-9-16(2)3/h4,6,8-9,13-14H,5,7H2,1-3H3/b15-9+ |
| InChIKey | ASTYJSMMPHXFMC-OQLLNIDSSA-N |
| XLogP | 2.11 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide?
The IUPAC name of N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide (CID 59966268) is N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide.
What is the SMILES notation for N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide?
The canonical SMILES for N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide is CNC1CCc2ccc(/N=C/N(C)C)cc21.
What is the InChIKey of N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide?
The InChIKey is ASTYJSMMPHXFMC-OQLLNIDSSA-N. The full InChI is InChI=1S/C13H19N3/c1-14-13-7-5-10-4-6-11(8-12(10)13)15-9-16(2)3/h4,6,8-9,13-14H,5,7H2,1-3H3/b15-9+.
What are the key properties of N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide?
N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide has a molecular weight of 217.32 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-[3-(methylamino)-2,3-dihydro-1H-inden-5-yl]methanimidamide is sourced from PubChem (CID 59966268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).