C21H32O4 — CID 155206934
(1S,3S,5S,6S,7R,9R,10S)-9-buta-1,3-dien-2-yl-5,7-dihydroxy-3-methoxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one (PubChem CID 155206934) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1S,3S,5S,6S,7R,9R,10S)-9-buta-1,3-dien-2-yl-5,7-dihydroxy-3-methoxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one.
| Compound Name | (1S,3S,5S,6S,7R,9R,10S)-9-buta-1,3-dien-2-yl-5,7-dihydroxy-3-methoxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one |
|---|---|
| PubChem CID | 155206934 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1S,3S,5S,6S,7R,9R,10S)-9-buta-1,3-dien-2-yl-5,7-dihydroxy-3-methoxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one |
| SMILES | C=CC(=C)[C@@H]1C[C@@H](O)[C@]2(C)C(C)CC[C@]3(C[C@H](OC)C(=O)[C@]32O)[C@H]1C |
| InChI | InChI=1S/C21H32O4/c1-7-12(2)15-10-17(22)19(5)13(3)8-9-20(14(15)4)11-16(25-6)18(23)21(19,20)24/h7,13-17,22,24H,1-2,8-11H2,3-6H3/t13?,14-,15-,16-,17+,19-,20-,21+/m0/s1 |
| InChIKey | NAZMOAZHWROHBX-WFCMGLQRSA-N |
| XLogP | 2.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|