C15H26N2 — CID 155208602
(3Z)-3-(ethylideneamino)-N,6-dimethyl-5-methylidene-N-propan-2-ylhepta-1,3-dien-2-amine (PubChem CID 155208602) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (3Z)-3-(ethylideneamino)-N,6-dimethyl-5-methylidene-N-propan-2-ylhepta-1,3-dien-2-amine.
| Compound Name | (3Z)-3-(ethylideneamino)-N,6-dimethyl-5-methylidene-N-propan-2-ylhepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 155208602 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (3Z)-3-(ethylideneamino)-N,6-dimethyl-5-methylidene-N-propan-2-ylhepta-1,3-dien-2-amine |
| SMILES | C=C(/C=C(\N=C\C)C(=C)N(C)C(C)C)C(C)C |
| InChI | InChI=1S/C15H26N2/c1-9-16-15(10-13(6)11(2)3)14(7)17(8)12(4)5/h9-12H,6-7H2,1-5,8H3/b15-10-,16-9+ |
| InChIKey | GTJPKBIWPHQWID-KJZZCODFSA-N |
| XLogP | 4.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|