C20H30N2O — CID 155211496
(1S,5R)-6-(4-ethoxyphenyl)spiro[2,6-diazabicyclo[3.2.2]nonane-9,1'-cyclohexane] (PubChem CID 155211496) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S,5R)-6-(4-ethoxyphenyl)spiro[2,6-diazabicyclo[3.2.2]nonane-9,1'-cyclohexane].
| Compound Name | (1S,5R)-6-(4-ethoxyphenyl)spiro[2,6-diazabicyclo[3.2.2]nonane-9,1'-cyclohexane] |
|---|---|
| PubChem CID | 155211496 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (1S,5R)-6-(4-ethoxyphenyl)spiro[2,6-diazabicyclo[3.2.2]nonane-9,1'-cyclohexane] |
| SMILES | CCOc1ccc(N2C[C@@H]3CC4(CCCCC4)[C@H]2CCN3)cc1 |
| InChI | InChI=1S/C20H30N2O/c1-2-23-18-8-6-17(7-9-18)22-15-16-14-20(11-4-3-5-12-20)19(22)10-13-21-16/h6-9,16,19,21H,2-5,10-15H2,1H3/t16-,19+/m0/s1 |
| InChIKey | ZCAOXDSHLHYYDC-QFBILLFUSA-N |
| XLogP | 3.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|