C17H26N2O — CID 155220705
(1S)-6-(4-ethoxyphenyl)-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonane (PubChem CID 155220705) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (1S)-6-(4-ethoxyphenyl)-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonane.
| Compound Name | (1S)-6-(4-ethoxyphenyl)-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 155220705 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (1S)-6-(4-ethoxyphenyl)-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonane |
| SMILES | CCOc1ccc(N2C[C@@H]3CC(C)(C)C2CCN3)cc1 |
| InChI | InChI=1S/C17H26N2O/c1-4-20-15-7-5-14(6-8-15)19-12-13-11-17(2,3)16(19)9-10-18-13/h5-8,13,16,18H,4,9-12H2,1-3H3/t13-,16?/m0/s1 |
| InChIKey | UCVZNUWNGGHFGY-KNVGNIICSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|