C22H32N4O — CID 138552251
(1R)-6-(4-ethoxyphenyl)-9,9-dimethyl-3-[2-(1H-pyrazol-4-yl)ethyl]-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 138552251) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is (1R)-6-(4-ethoxyphenyl)-9,9-dimethyl-3-[2-(1H-pyrazol-4-yl)ethyl]-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | (1R)-6-(4-ethoxyphenyl)-9,9-dimethyl-3-[2-(1H-pyrazol-4-yl)ethyl]-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 138552251 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (1R)-6-(4-ethoxyphenyl)-9,9-dimethyl-3-[2-(1H-pyrazol-4-yl)ethyl]-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | CCOc1ccc(N2C[C@H]3CN(CCc4cn[nH]c4)CC2C(C)(C)C3)cc1 |
| InChI | InChI=1S/C22H32N4O/c1-4-27-20-7-5-19(6-8-20)26-15-18-11-22(2,3)21(26)16-25(14-18)10-9-17-12-23-24-13-17/h5-8,12-13,18,21H,4,9-11,14-16H2,1-3H3,(H,23,24)/t18-,21?/m1/s1 |
| InChIKey | CNKLBKJRADFVPR-ITUIMRKVSA-N |
| XLogP | 3.59 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|