C22H36N4O4S — CID 162699541
N-[2-(2-aminoethylsulfonyl)ethyl]-6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (PubChem CID 162699541) has the molecular formula C22H36N4O4S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[2-(2-aminoethylsulfonyl)ethyl]-6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
| Compound Name | N-[2-(2-aminoethylsulfonyl)ethyl]-6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
|---|---|
| PubChem CID | 162699541 |
| Molecular Formula | C22H36N4O4S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-[2-(2-aminoethylsulfonyl)ethyl]-6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| SMILES | CCOc1ccc(N2CC3CN(C(=O)NCCS(=O)(=O)CCN)CC2C(C)(C)C3)cc1 |
| InChI | InChI=1S/C22H36N4O4S/c1-4-30-19-7-5-18(6-8-19)26-15-17-13-22(2,3)20(26)16-25(14-17)21(27)24-10-12-31(28,29)11-9-23/h5-8,17,20H,4,9-16,23H2,1-3H3,(H,24,27) |
| InChIKey | XMHSKBWMYDCTKA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|