C24H40N4O5S — CID 166949070
(5S)-9-[4-[3-(2-aminoethylsulfonyl)propoxy]phenyl]-N-(2-hydroxyethyl)-7,7-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide (PubChem CID 166949070) has the molecular formula C24H40N4O5S and a molecular weight of 496.67 g/mol. Its IUPAC name is (5S)-9-[4-[3-(2-aminoethylsulfonyl)propoxy]phenyl]-N-(2-hydroxyethyl)-7,7-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide.
| Compound Name | (5S)-9-[4-[3-(2-aminoethylsulfonyl)propoxy]phenyl]-N-(2-hydroxyethyl)-7,7-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide |
|---|---|
| PubChem CID | 166949070 |
| Molecular Formula | C24H40N4O5S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (5S)-9-[4-[3-(2-aminoethylsulfonyl)propoxy]phenyl]-N-(2-hydroxyethyl)-7,7-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide |
| SMILES | CC1(C)CC2CN(C(=O)NCCO)C[C@H](CN2c2ccc(OCCCS(=O)(=O)CCN)cc2)C1 |
| InChI | InChI=1S/C24H40N4O5S/c1-24(2)14-19-16-27(23(30)26-9-10-29)18-21(15-24)28(17-19)20-4-6-22(7-5-20)33-11-3-12-34(31,32)13-8-25/h4-7,19,21,29H,3,8-18,25H2,1-2H3,(H,26,30)/t19-,21?/m1/s1 |
| InChIKey | JVNPNMNGYWCIQO-YMBRHYMPSA-N |
| XLogP | 1.46 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|