C22H34N4O4S — CID 155220791
(1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-(2-hydroxyethyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (PubChem CID 155220791) has the molecular formula C22H34N4O4S and a molecular weight of 450.61 g/mol. Its IUPAC name is (1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-(2-hydroxyethyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
| Compound Name | (1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-(2-hydroxyethyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
|---|---|
| PubChem CID | 155220791 |
| Molecular Formula | C22H34N4O4S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-(2-hydroxyethyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| SMILES | CC1(C)C[C@@H]2CN(C(=O)NCCO)C[C@H]1N(c1ccc(N3CCS(=O)(=O)CC3)cc1)C2 |
| InChI | InChI=1S/C22H34N4O4S/c1-22(2)13-17-14-25(21(28)23-7-10-27)16-20(22)26(15-17)19-5-3-18(4-6-19)24-8-11-31(29,30)12-9-24/h3-6,17,20,27H,7-16H2,1-2H3,(H,23,28)/t17-,20-/m1/s1 |
| InChIKey | HGPDIHLJHHZJHE-YLJYHZDGSA-N |
| XLogP | 1.16 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|