C19H27N3O3S — CID 138543797
(1R,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonan-3-one (PubChem CID 138543797) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is (1R,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonan-3-one.
| Compound Name | (1R,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonan-3-one |
|---|---|
| PubChem CID | 138543797 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (1R,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-2,6-diazabicyclo[3.2.2]nonan-3-one |
| SMILES | CC1(C)C[C@@H]2CN(c3ccc(N4CCS(=O)(=O)CC4)cc3)[C@H]1CC(=O)N2 |
| InChI | InChI=1S/C19H27N3O3S/c1-19(2)12-14-13-22(17(19)11-18(23)20-14)16-5-3-15(4-6-16)21-7-9-26(24,25)10-8-21/h3-6,14,17H,7-13H2,1-2H3,(H,20,23)/t14-,17+/m1/s1 |
| InChIKey | IYOFGUQFYOTAAH-PBHICJAKSA-N |
| XLogP | 1.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|