C20H31N3 — CID 163653681
(1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 163653681) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is (1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | (1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 163653681 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | CC1(C)C[C@@H]2CNC[C@H]1N(c1ccc(N3CCCCC3)cc1)C2 |
| InChI | InChI=1S/C20H31N3/c1-20(2)12-16-13-21-14-19(20)23(15-16)18-8-6-17(7-9-18)22-10-4-3-5-11-22/h6-9,16,19,21H,3-5,10-15H2,1-2H3/t16-,19-/m1/s1 |
| InChIKey | POIGSBSTPIVJDB-VQIMIIECSA-N |
| XLogP | 3.50 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|