C20H29N3O — CID 161049744
(1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-2,6-diazabicyclo[3.2.2]nonan-3-one (PubChem CID 161049744) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is (1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-2,6-diazabicyclo[3.2.2]nonan-3-one.
| Compound Name | (1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-2,6-diazabicyclo[3.2.2]nonan-3-one |
|---|---|
| PubChem CID | 161049744 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (1R,5S)-9,9-dimethyl-6-(4-piperidin-1-ylphenyl)-2,6-diazabicyclo[3.2.2]nonan-3-one |
| SMILES | CC1(C)C[C@@H]2CN(c3ccc(N4CCCCC4)cc3)[C@H]1CC(=O)N2 |
| InChI | InChI=1S/C20H29N3O/c1-20(2)13-15-14-23(18(20)12-19(24)21-15)17-8-6-16(7-9-17)22-10-4-3-5-11-22/h6-9,15,18H,3-5,10-14H2,1-2H3,(H,21,24)/t15-,18+/m1/s1 |
| InChIKey | UBZABGQRYJDFRW-QAPCUYQASA-N |
| XLogP | 3.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|